Zu "2249801-12-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
MD2-TLR4-IN-1
Artikelnummer: TGM-T7672-100mg
Description: MD2-TLR4-IN-1 is a myeloid differentiation protein 2/toll-like receptor 4 (MD2-TLR4) complex inhibitor. Target: TLR. Smiles: Clc1cccc(Cl)c1C(=O)Nc1ccc2[nH]nc(-c3ccc4[nH]ccc4c3)c2c1. References: Zhiguo, Liu, Lingfeng, et al. Discovery of 3-(Indol-5-yl)-indazole Derivatives as Novel Myeloid...
| Anwendung: | TLR4 antagonist |
| CAS | 2249801-12-3 |
| MW: | 421.28 D |
ab 91,00 €
MD2-TLR4-I
Artikelnummer: Cay38328-1
MD2-TLR4-I is a toll-like receptor 4 (TLR4) antagonist. It inhibits LPS-induced production of TNF-alpha and IL-6 in primary mouse macrophages (IC50s = 0.89 and 0.53 µM, respectively). MD2-TLR4-I inhibits LPS-induced, TLR4-mediated NF-kappaB activation in a reporter assay using RAW 264.7 cells. In vivo, MD2-TLR4-I...
| Schlagworte: | Myeloid Differentiation Factor 2-Toll-like Receptor 4-I, 2,6-dichloro-N-[3-(1H-indol-5-yl)-1H-indazol-5-yl]-benzamide |
| Anwendung: | TLR4 antagonist |
| CAS | 2249801-12-3 |
| MW: | 421.3 D |
ab 90,00 €
