Zu "22457-89-2" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Benfotiamine
Artikelnummer: TGM-T1129-100mg
Description: Benfotiamine (S-Benzoylthiamine O-monophosphate) is a synthetic S-acyl derivative of thiamine (vitamin B1) employed as an antioxidant dietary supplement. Target: Others. Smiles: C(N(C(=C(SC(=O)C1=CC=CC=C1)CCOP(=O)(O)O)C)C=O)C=2C(N)=NC(C)=NC2. References: Bozic I, et al. PLoS One. 2015 Feb...
| Schlagworte: | Benzoylthiamine monophosphate, S-Benzoylthiamine O-monophosphate |
| CAS | 22457-89-2 |
| MW: | 466.45 D |
ab 34,00 €
Benfotiamine
Artikelnummer: Cay22192-1
Benfotiamine is a lipid-soluble form of vitamin B1 (thiamine). In vitro, it corrects defective replication of, and prevents formation of advanced glycosylation end products (AGEs) in, human umbilical vein endothelial cells (HUVECs) grown under high glucose conditions. In vivo, administration of benfotiamine...
| Schlagworte: | Benzoylthiamine monophosphate, benzenecarbothioic acid,... |
| Anwendung: | Lipid-soluble vitamin B1 derivative |
| CAS | 22457-89-2 |
| MW: | 466.5 D |
ab 61,00 €
Benfotiamine
Artikelnummer: LKT-B1753.1
A lipid-soluble thiamine derivative found in Allium family vegetables such as garlic, onions, leeks and shallots. As a treatment for diabetic neuropathy, benfotiamine is more effective at increasing thiamine levels in blood and tissues than water-soluble salts like the previous vitamin B1.
| Schlagworte: | S-Benzoylthiamine O-monophosphate |
| Anwendung: | Metabolic studies |
| CAS | 22457-89-2 |
| MW: | 466,45 D |
ab 109,00 €
S-Benzoylthiamine O-monophosphate
Artikelnummer: CDX-B0403-G001
S-Benzoylthiamine O-monophosphate is a lipid-soluble form of vitamin B1 (thiamine). S-Benzoylthiamine O-monophosphate facilitates the action of thiamine diphosphate, a cofactor for the enzyme transketolase. The activation of transketolase enzyme accelerates the precursors of advanced glycation end products (AGEs)...
| Schlagworte: | Benfotiamine, Benzoylthiamine monophosphate |
| Anwendung: | Lipid-soluble vitamin B1 (thiamine) form |
| CAS | 22457-89-2 |
| MW: | 466.45 D |
ab 91,00 €
