Zu "2244-11-3" wurden 3 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Alloxan monohydrate
Alloxan monohydrate

Artikelnummer: TGM-T7814-1g

Description: Alloxan Monohydrate is a glucose analog used to induce diabetes by destroying beta-cells. Target: Proteasome. Smiles: O.O=C1NC(=O)C(=O)C(=O)N1. References: Major species differences between humans and rodents in the susceptibility to pancreatic beta-cell injury.
CAS 2244-11-3
MW: 160.09 D
30,00 €
Bewerten
Alloxan (hydrate)
Alloxan (hydrate)

Artikelnummer: Cay9002196-5

Alloxan is a toxin that selectively eliminates pancreatic beta-cells in mice, rats, and certain other animals, and is used to model type 1 diabetes in humans. Reduction of alloxan within beta-cells precedes the generation of reactive oxygen species, which in turn contribute to beta-cell death. The dose of alloxan...
Schlagworte: 2,4,5,6(1H,3H)-pyrimidinetetrone, monohydrate
Anwendung: beta-cell elimination
CAS 2244-11-3
MW: 160.1 D
ab 44,00 €
Bewerten
Alloxan Monohydrate
Alloxan Monohydrate

Artikelnummer: LKT-A4547.10

Pyrimidine, glucose analog, used to induce diabetes
Schlagworte: Alloxan, 2,4,5,6(1H,3H)-pyrimidinetetrone monohydrate
Anwendung: Pyrimidine, glucose analog, used to induce diabetes
CAS 2244-11-3
MW: 160.08 D
ab 71,00 €
Bewerten