Zu "2226735-55-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GSK547
Artikelnummer: TGM-T7397-100mg
Description: GSK547 (GSK'547) is a highly selective and potent RIP1 kinase inhibitor that disrupts macrophage-mediated adaptive immune tolerance in pancreatic cancer. Target: RIP kinase. Smiles: Fc1cc(F)cc(c1)[C@@H]1CC=NN1C(=O)C1CCN(CC1)c1cc(ncn1)C#N. References: RIP1 Kinase Drives Macrophage-Mediated Adaptive...
| Schlagworte: | GSK'547 |
| Anwendung: | RIPK1 inhibitor |
| CAS | 2226735-55-1 |
| MW: | 396.39 D |
ab 41,00 €
GSK547
Artikelnummer: Cay37347-1
GSK547 is an inhibitor of receptor-interacting serine/threonine kinase 1 (RIPK1, IC50 = 31 nM). It is selective for RIPK1 over a panel of 371 kinases, including RIPK2, -3, -4, and -5, at 10 µM. In vivo, GSK547 (100 mg/kg) increases survival and reduces tumor volume and the number of liver metastases in a P48Cre...
| Schlagworte: | RIP1i, 6-[4-[[(5S)-5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]carbonyl]-1-piperidinyl]-4-pyrimidinecarbonitrile |
| Anwendung: | RIPK1 inhibitor |
| CAS | 2226735-55-1 |
| MW: | 396.4 D |
ab 40,00 €
