Zu "22232-54-8" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Carbimazole
Artikelnummer: TGM-T0952-1mL
Description: Carbimazole (Athyromazole) is an Imidazolium thyroid antagonist, which is rapidly transformed into MMI in vivo and can be converted into methidazole in vitro, and can be used in the study of Graves' disease. Target: Thyroid hormone receptor(THR). Smiles: C(OCC)(=O)N1C(=S)N(C)C=C1. References: Taurog A,...
| Schlagworte: | Neomercazole, Carbimazol, Athyromazole |
| CAS | 22232-54-8 |
| MW: | 186.23 D |
ab 31,00 €
Carbimazole
Artikelnummer: LKT-C0172.1
Carbimazole is a thyroid inhibitor.
| Schlagworte: | Athyromazole, Neo-mercazole, Neo-Thyreostat |
| Anwendung: | Antithyroid |
| CAS | 22232-54-8 |
| MW: | 186.23 D |
ab 96,00 €
Carbimazole
Artikelnummer: Cay28280-10
Carbimazole is a prodrug form of the thyroid hormone synthesis inhibitor methimazole (Cay-23718). Carbimazole (15 mg/animal) reduces total thyroxine concentration, thyroid enlargement, polyphagia, anorexia, and alopecia in a cat model of hyperthyroidism.Formal Name:...
| Schlagworte: | 2,3-dihydro-3-methyl-2-thioxo-1H-imidazole-1-carboxylic acid, ethyl ester |
| Anwendung: | Methimazole prodrug, antithyroid, thyroid hormone synthesis inhibitor |
| CAS | 22232-54-8 |
| MW: | 186.2 D |
ab 78,00 €
Carbimazole
Artikelnummer: LKT-C0172.100
Methimazole prodrug, thyroid peroxidase inhibitor.
| Schlagworte: | Athyromazole, Neo-mercazole, Neo-Thyreostat, 2,3-Dihydro-3-methyl-2-thioxo-1H-imidazole-1- carboxylic acid ethyl ester |
| Anwendung: | Antithyroid |
| CAS | 22232-54-8 |
| MW: | 186.23 D |
67,00 €
