Zu "2222-07-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Cucurbitacin I
Artikelnummer: TGM-TQ0196-1mg
Description: Cucurbitacin I (JSI-124), a natural compound, is a selective inhibitor of JAK2/STAT3 with anti-cancer activity. Target: STAT, JAK. Smiles: [H][C@@]12CC=C3[C@@]([H])(C=C(O)C(=O)C3(C)C)[C@]1(C)C(=O)C[C@]1(C)[C@H]([C@H](O)C[C@@]21C)[C@@](C)(O)C(=O)\C=C\C(C)(C)O. References: Song J, et al. Cucurbitacin I...
| Schlagworte: | JSI-124, NSC-521777, Elatericin B |
| Anwendung: | STAT3/JAK signaling pathway inhibitor |
| CAS | 2222-07-3 |
| MW: | 514.65 D |
ab 76,00 €
Cucurbitacin I
Artikelnummer: Cay14747-1
Cucurbitacin I is triterpenoid compound that acts as a potent inhibitor of the STAT3/JAK signaling pathway. It specifically suppresses levels of tyrosine phosphorylated STAT3 in v-Src-transformed NIH 3T3 cells and in A549 cells (IC50 = 500 nM) resulting in inhibition of STAT3 DNA binding and reduced STAT3-mediated...
| Schlagworte: | Elatericin B, JSI-124, NSC 521777,... |
| Anwendung: | STAT3/JAK signaling pathway inhibitor |
| CAS | 2222-07-3 |
| MW: | 514.7 D |
ab 129,00 €
