Zu "220941-93-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CP-226269
Artikelnummer: TGM-T27060-100mg
Description: CP-226269 is a potent dopamine D4 receptor agonist that regulates calcium flux and has an EC50 value of 32.0 nM. CP 226269 can be used to study neurological disorders such as schizophrenia. Target: Dopamine Receptor. Smiles: C(C=1NC=2C(C1)=CC(F)=CC2)N3CCN(CC3)C4=CC=CC=N4. References: Robert B Moreland,...
| Schlagworte: | CP 226269, CP226269 |
| Anwendung: | Dopamine D4 receptor agonist |
| CAS | 220941-93-5 |
| MW: | 310.37 D |
ab 96,00 €
CP 226,269
Artikelnummer: Cay36493-1
CP 226,269 is a dopamine D4 receptor agonist. It induces calcium flux in HEK293 cells co-expressing human dopamine D4, but not D2L or D3, receptors and Galphaqo5 (EC50s = 32, >10,000, and 985 nM, respectively). CP 226,269 induces phospholipid methylation in SK-N-MC neuroblastoma cells, which endogenously express...
| Schlagworte: | 5-fluoro-2-[[4-(2-pyridinyl)-1-piperazinyl]methyl]-1H-indole |
| Anwendung: | Dopamine D4 receptor agonist |
| CAS | 220941-93-5 |
| MW: | 310.4 D |
ab 39,00 €
