Zu "219138-02-0" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Z-IETD-AFC
Artikelnummer: TGM-T36333-100mg
Description: Z-IETD-AFC is a fluorescent substrate for caspase-8 and granzyme B. It can be used to quantify cysteinyl aspartate-8 or granzyme B activity. Smiles: CC[C@H](C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(O)=O)C(=O)Nc1ccc2c(cc(=O)oc2c1)C(F)(F)F. References: Boudard...
| Anwendung: | Caspase-8 substrate |
| CAS | 219138-02-0 |
| MW: | 821.75 D |
ab 60,00 €
Z-IETD-AFC
Artikelnummer: ABD-13425
A fluorogenic caspase-8/granzyme B substrate containing the benzyloxycarbonyl (Z) moiety.
| Anwendung: | Caspase-8 substrate |
| CAS | 219138-02-0 |
181,00 €
Z-IETD-AFC
Artikelnummer: Cay27101-1
Z-IETD-AFC is a fluorogenic substrate for caspase-8 and granzyme B. Upon enzymatic cleavage by caspase-8 or granzyme B, 7-amino-4-trifluoromethylcoumarin (AFC) is released and its fluorescence can be used to quantify caspase-8 or granzyme B activity. AFC displays excitation/emission maxima of 400/505 nm,...
| Schlagworte: | Z-Ile-Glu-Thr-Asp-7-amino-4-Trifluormethylcoumarin,... |
| Anwendung: | Caspase-8 / granzyme B fluorogenic substrate |
| CAS | 219138-02-0 |
| MW: | 821.8 D |
ab 85,00 €
