Zu "217500-96-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Tulathromycin A
Artikelnummer: TGM-T4267-100mg
Description: Tulathromycin A (CP 472295) is a macrolide antibiotic. Target: Antibacterial, Antibiotic. Smiles: [H][C@@]1(C[C@@](C)(OC)[C@](O)(CNCCC)[C@H](C)O1)O[C@H]1[C@H](C)[C@@H](O[C@]2([H])O[C@H](C)C[C@@H]([C@H]2O)N(C)C)[C@](C)(O)C[C@@H](C)CN[C@H](C)[C@@H](O)[C@](C)(O)[C@@H](CC)OC(=O)[C@@H]1C. References:...
| Schlagworte: | Draxxin, Tulathromycin, CP 472295 |
| Anwendung: | Bacterial protein synthesis inhibitor |
| CAS | 217500-96-4 |
| MW: | 806.08 D |
ab 39,00 €
Tulathromycin A
Artikelnummer: Cay19202-25
Tulathromycin A is a macrolide antibiotic that inhibits bacterial protein synthesis (IC50 = 0.26 µM) by targeting the 50S ribosomal subunit, blocking the progression of nascent polypeptide chains. It is effective against M. haemolytica and P. multocida (MICs = 2 and 0.5 µg/ml, respectively), which cause respiratory...
| Schlagworte: | CP 472,295,... |
| Anwendung: | Bacterial protein synthesis inhibitor |
| CAS | 217500-96-4 |
| MW: | 806.1 D |
ab 77,00 €
