Zu "214491-43-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
DiFMUP
Artikelnummer: TGM-T31458-1mg
Description: DiFMUP (6,8-Difluoro-4-methylumbelliferyl phosphate) inhibits protein tyrosine phosphatases (PTPs) and can be used to assay threonine phosphatase activity. Smiles: O=C1OC=2C(F)=C(OP(=O)(O)O)C(F)=CC2C(=C1)C. References: Gee KR, et al. Fluorogenic substrates based on fluorinated umbelliferones for...
| Schlagworte: | 6,8-Difluoro-4-methylumbelliferyl phosphate |
| Anwendung: | Fluorogenic phosphatase substrate |
| CAS | 214491-43-7 |
| MW: | 292.13 D |
ab 69,00 €
DiFMUP
Artikelnummer: Cay35500-1
DiFMUP is a fluorogenic substrate for phosphatases. Upon enzymatic cleavage by phosphatases, 6,8-difluoro-7-hydroxy-4-methylcoumarin (Cay-36017) is released, which has an absorption/emission maxima of 358/455 nm, respectively, and its fluorescence can be used to quantify phosphatase activity. DiFMUP has been used to...
| Schlagworte: | 6,8-difluoro-4-Methylumbelliferyl phosphate, 6,8-difluoro-4-methyl-7-(phosphonooxy)-2H-1-benzopyran-2-one |
| Anwendung: | Fluorogenic phosphatase substrate |
| CAS | 214491-43-7 |
| MW: | 292.1 D |
ab 67,00 €
