Zu "2133417-13-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ralmitaront
Artikelnummer: TGM-T9183-100mg
Description: Ralmitaront (RO6889450) is a potent, orally active partial agonist of the trace amine-associated receptor 1 (TAAR1). Target: Others. Smiles: CCc1[nH]nc(C(=O)Nc2ccc(cc2)[C@H]2CNCCO2)c1C. References: Brady LS, Potter WZ, Gordon JA. Redirecting the revolution: new developments in drug development for...
| Schlagworte: | RO6889450 |
| Anwendung: | Targets trace amine associated receptor (TAAR) |
| CAS | 2133417-13-5 |
| MW: | 314.38 D |
ab 110,00 €
Ralmitaront
Artikelnummer: Cay41111-1
Ralmitaront is an agonist of trace amine-associated receptor 1 (TAAR1). It induces cAMP accumulation in HEK293T cells expressing human TAAR1 (EC50 = 17.78 nM).Formal Name: 5-ethyl-4-methyl-N-[4-(2S)-2-morpholinylphenyl]-1H-pyrazole-3-carboxamide. CAS Number: 2133417-13-5. Synonyms: RG-7906, RO6889450. Molecular...
| Schlagworte: | RG-7906, RO6889450, 5-ethyl-4-methyl-N-[4-(2S)-2-morpholinylphenyl]-1H-pyrazole-3-carboxamide |
| Anwendung: | TAAR1 agonist |
| CAS | 2133417-13-5 |
| MW: | 314.4 D |
ab 150,00 €
