Zu "2095432-55-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SR-18292
Artikelnummer: TGM-T4353-100mg
Description: SR-18292 is an inhibitor of PPAR gamma coactivator-1alpha (PGC-1alpha), which increases PGC-1alpha acetylation, suppresses gluconeogenic gene expression and reduces glucose production in hepatocytes. Target: Autophagy. Smiles: Cc1ccc(CN(CC(O)COc2cccc3[nH]ccc23)C(C)(C)C)cc1. References: Sharabi...
| Schlagworte: | SR 18292 |
| Anwendung: | PPARGC1A inhibitor |
| CAS | 2095432-55-4 |
| MW: | 366.5 D |
ab 34,00 €
SR 18292
Artikelnummer: Cay22084-5
SR 18292 is an inhibitor of peroxisome proliferator-activated receptor-gamma coactivator-1alpha (PGC-1alpha), a coactivator of transcription factors for genes involved in gluconeogenesis. SR 18292 (20 µM) increases acetylation of PGC-1alpha and, subsequently, decreases mRNA expression of phosphoenolpyruvate...
| Schlagworte: | 1-[(1,1-dimethylethyl)[(4-methylphenyl)methyl]amino]-3-(1H-indol-4-yloxy)-2-propanol |
| Anwendung: | PPARGC1A inhibitor |
| CAS | 2095432-55-4 |
| MW: | 366.5 D |
ab 44,00 €
