Zu "206873-63-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Tariquidar
Artikelnummer: TGM-T6287-100mg
Description: Tariquidar (XR9576)(Kd=5.1 nM) is a specific and effective non-competitive inhibitor of P-glycoprotein. It can reverse drug resistance in MDR cell Lines. Target: P-gp. Smiles: COc1cc2CCN(CCc3ccc(NC(=O)c4cc(OC)c(OC)cc4NC(=O)c4cnc5ccccc5c4)cc3)Cc2cc1OC. References: Martin C, et al. Br J Pharmacol, 1999,...
| Schlagworte: | XR9576 |
| Anwendung: | Targets ATP-binding cassette, subfamily B (MDR/TAP), member 1 [EC:7.6.2.2] (ABCB1, CD243) |
| CAS | 206873-63-4 |
| MW: | 646.73 D |
ab 45,00 €
Tariquidar
Artikelnummer: Cay24180-100
Tariquidar is an anthranilic acid derivative that binds to P-glycoprotein (Kd = 5.1 nM) and inhibits transport activity. It inhibits transport of vinblastine (Cay-11762) and paclitaxel (Cay-10461) in multidrug resistant CHrB30 cells, increasing the steady state accumulation to non-P-glycoprotein-expressing multidrug...
| Schlagworte: | XR9576,... |
| Anwendung: | P-Glycoprotein inhibitor |
| CAS | 206873-63-4 |
| MW: | 646.7 D |
ab 83,00 €
