Zu "2032-65-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Methiocarb
Artikelnummer: TGM-T21464-100mg
Description: Methiocarb, a carbamate pesticide, is used as an insecticide, acaricide, bird repellent, and molluscicide. Methiocarb stimulates cholinergic by inhibiting reversibly acetylcholinesterase activity, making methiocarb a potent neurotoxin. Target: Others. Smiles: O=C(OC=1C=C(C(SC)=C(C1)C)C)NC. References:...
| Schlagworte: | Mercaptodimethur, Mesurol |
| CAS | 2032-65-7 |
| MW: | 225.31 D |
ab 77,00 €
Methiocarb
Artikelnummer: Cay25627-100
Methiocarb is a carbamate pesticide. It inhibits the activity of acetylcholinesterase (AChE) from methiocarb-resistant and -sensitive western flower thrips (F. occidentalis, IC50s = 0.43 and 2.1 µM, respectively) and is toxic to the same strains (LC50s = 31.1 and 3.26 ppm for the resistant- and sensitive strains,...
| Schlagworte: | 4-Methylthio-3,5-dimethylphenyl methylcarbamate, BAY 37344, Mercaptodimethur, 3,5-dimethyl-4-(methylthio)-phenol,... |
| Anwendung: | Carbamate pesticide, AChE inhibitor |
| CAS | 2032-65-7 |
| MW: | 225.3 D |
ab 43,00 €
