Zu "200933-14-8" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
m-3M3FBS
Artikelnummer: TGM-T8531-100mg
Description: m-3M3FBS is a phospholipase C (PLC) activator. Target: Apoptosis, Phospholipase. Smiles: Cc1cc(C)c(c(C)c1)S(=O)(=O)Nc1cccc(c1)C(F)(F)F. References: Bae YS, et al. Identification of a compound that directly stimulates phospholipase C activity. Mol Pharmacol. 2003,63(5):1043-1050.
| Anwendung: | Cell permeable, specific phospholipase C (PLC) activator |
| CAS | 200933-14-8 |
| MW: | 343.36 D |
ab 43,00 €
m-3M3FBS
Artikelnummer: Cay16867-50
m-3M3FBS is an activator of phospholipase C (PLC) that stimulates superoxide generation, increase in cytoplasmic calcium, and inositol phosphate formation in human neutrophils when used at a concentration of 15-50 µM. It stimulates cytoplasmic calcium increases in several cell lines and, at 25 µM in vitro, promotes...
| Schlagworte: | 2,4,6-trimethyl-N-[3-(trifluoromethyl)phenyl]-benzenesulfonamide |
| Anwendung: | PLC activator |
| CAS | 200933-14-8 |
| MW: | 343.4 D |
ab 66,00 €
m-3M3FBS
Artikelnummer: AG-CR1-3548-M010
m-3M3FBS is a cell permeable and specific activator of phospholipase C (PLC) that has been shown to stimulate the PLC-mediated intracellular Ca2+ release, inositol phosphates production and superoxide generation in various cell types. It activates all PLC isotypes (beta2, beta3, gamma1, gamma2 and delta1) in vitro,...
| Schlagworte: | 2,4,6-Trimethyl-N-[3-(trifluoromethyl)phenyl]-benzenesulfonamide |
| Anwendung: | Cell permeable, specific phospholipase C (PLC) activator |
| CAS | 200933-14-8 |
| MW: | 343,4 D |
ab 83,00 €
