Zu "19983-44-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Stattic
Artikelnummer: TGM-T6308-100mg
Description: Stattic (STAT3 Inhibitor V) is a STAT3 inhibitor (IC50=5.1 µM) that selectively inhibits STAT3 activation, dimerization, and nuclear translocation. Stattic has antitumor activity and induces apoptosis. Target: Apoptosis, STAT. Smiles: [O-][N+](=O)C1=CC=C2C=CS(=O)(=O)C2=C1. References: Guo H, et al....
| Schlagworte: | STAT3 Inhibitor V |
| Anwendung: | STAT3 inhibitor |
| CAS | 19983-44-9 |
| MW: | 211.19 D |
ab 31,00 €
Stattic
Artikelnummer: Cay14590-10
Signal transducers and activators of transcription (STATs) are a family of latent cytoplasmic transcription factors that convey signals from the cell membrane to the nucleus. In various human tumors, STAT3 is constitutively activated by aberrant upstream tyrosine kinase activities. Stattic is a small molecule...
| Schlagworte: | STAT3 Inhibitor V, 6-nitro-1,1-dioxide-benzo[b]thiophene |
| Anwendung: | STAT3 inhibitor |
| CAS | 19983-44-9 |
| MW: | 211.2 D |
ab 77,00 €
