Zu "196961-43-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CD3254
Artikelnummer: TGM-T14912-1mg
Description: CD3254 is a selective and potent retinoid X receptor-like (RXR) agonist that inhibits neuronal cell death with OGD/reoxygenation. Target: Retinoid Receptor. Smiles: Cc1cc2c(cc1-c1cc(\C=C/C(O)=O)ccc1O)C(C)(C)CCC2(C)C. References: Nahoum V, et al. Modulators of the structural dynamics of the retinoid X...
| Anwendung: | Selective RXR alpha agonist |
| CAS | 196961-43-0 |
| MW: | 364.48 D |
49,00 €
CD3254
Artikelnummer: Cay20870-1
CD3254 is a selective agonist of the retinoid X receptors (RXRs, EC50 = ~10 nM for human RXRbeta) that is without effect on retinoic acid receptors (RARs). It stimulates the recruitment of the nuclear receptor interaction domain of the TRAP220 coactivator to RXRalpha/RARbeta heterodimers in vitro. CD3254 also...
| Schlagworte: | 3-[4-hydroxy-3-(5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenyl)phenyl]-2-propenoic acid |
| Anwendung: | Selective RXR alpha agonist |
| CAS | 196961-43-0 |
| MW: | 364.5 D |
ab 45,00 €
