Zu "193275-84-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Lonafarnib
Artikelnummer: TGM-T6302-100mg
Description: Lonafarnib (Sch66336) is an orally bioavailable FPTase inhibitor for H-ras, K-ras-4B, and N-ras (IC50: 1.9/5.2/2.8 nM). Target: Autophagy, Transferase, Raf, Ras. Smiles: NC(=O)N1CCC(CC(=O)N2CCC(CC2)[C@H]2c3ncc(Br)cc3CCc3cc(Cl)cc(Br)c23)CC1. References: Liu M, et al. Cancer Res, 1998, 58(21), 4947-4956.
| Schlagworte: | Sch66336, Sarasar |
| Anwendung: | Antineoplastic, Farnesyltransferase inhibitor |
| CAS | 193275-84-2 |
| MW: | 638.82 D |
ab 41,00 €
Lonafarnib
Artikelnummer: Cay11746-1
Farnesyltransferase drives the post-translational farnesylation of a number of target proteins, including Ras, a component of the MAPK and Akt signaling pathways involved in cell proliferation, and Ras homolog enriched in brain (Rheb), which stimulates mTOR activity. By arresting growth, farnesyltransferase...
| Schlagworte: | Sarasar, SCH 66336,... |
| Anwendung: | Farnesyl transferase inhibitor |
| CAS | 193275-84-2 |
| MW: | 638.8 D |
ab 44,00 €
