Zu "1912445-55-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Branebrutinib
Artikelnummer: TGM-T5407-100mg
Description: Branebrutinib (BMS986195) is a potent, covalent inhibitor of Bruton's tyrosine kinase (BTK), >5,000-fold selective over all kinases outside of the Tec family (IC50 <1 nM for BTK). Target: BTK. Smiles: CC#CC(=O)N[C@H]1CCCN(C1)c1c(F)cc(C(N)=O)c2[nH]c(C)c(C)c12. References: JR Burke, et al. BMS-986195 Is a...
| Schlagworte: | BMS986195 |
| Anwendung: | Targets Bruton agammaglobulinemia tyrosine kinase [EC:2.7.10.2] (BTK) |
| CAS | 1912445-55-6 |
| MW: | 370.42 D |
ab 55,00 €
Branebrutinib
Artikelnummer: Cay33462-1
Branebrutinib is a covalent inhibitor of Bruton's tyrosine kinase (BTK, IC50 = 0.1 nM). It is greater than 5,000-fold selective for BTK over a panel of 240 kinases but does inhibit the additional Tec family kinases Tec, BMX, and TMX (IC50s = 0.9, 1.5, and 5 nM, respectively). Branebrutinib inhibits calcium flux in...
| Schlagworte: | BMS-986195, 5-fluoro-2,3-dimethyl-4-[(3S)-3-[(1-oxo-2-butyn-1-yl)amino]-1-piperidinyl]-1H-indole-7-carboxamide |
| Anwendung: | Covalent BTK inhibitor |
| CAS | 1912445-55-6 |
| MW: | 370.4 D |
ab 44,00 €
