Zu "1821428-35-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AZD0156
Artikelnummer: TGM-T6770-100mg
Description: AZD0156 , an effective and specific inhibitors of ATM kinase, is potential antineoplastic activities and chemo-/radio-sensitizing. Target: Apoptosis, ATM/ATR. Smiles: CN(C)CCCOc1ccc(cn1)-c1ccc2ncc3n(C)c(=O)n(C4CCOCC4)c3c2c1. References: WO2015170081A1 - Imidazo[4,5-c]quinolin-2-one compounds and their...
| Anwendung: | ATM kinase inhibitor |
| CAS | 1821428-35-6 |
| MW: | 461.56 D |
ab 32,00 €
AZD 0156
Artikelnummer: Cay25648-10
AZD 0156 is an inhibitor of the ataxia-telangiectasia mutated (ATM) kinase (IC50s = 0.04 and 0.57 nM in enzyme and cell-based assays, respectively). It is selective for ATM over other PI3K-related kinase (PIKK) family kinases including DNA-PK, mTOR, PI3Kalpha, PI3Kbeta, PI3Kgamma, and PI3Kdelta (IC50s = 0.14, 0.20,...
| Schlagworte: | 8-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-1,3-dihydro-3-methyl-1-(tetrahydro-2H-pyran-4-yl)-2H-imidazo[4,5-c]quinolin-2... |
| Anwendung: | ATM kinase inhibitor |
| CAS | 1821428-35-6 |
| MW: | 461.6 D |
ab 158,00 €
AZD-0156
Artikelnummer: LKT-A985120.100
| Schlagworte: | AZD 0156, AZD0156 |
| Anwendung: | ATM kinase inhibitor |
| CAS | 1821428-35-6 |
| MW: | 461.57 D |
ab 126,00 €
