Zu "1809581-87-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
MM-206
Artikelnummer: TGM-T28075-10mg
Description: MM-206, a cell-permeable, non-cytotoxic naphthalene sulfonamide compound, it effectively inhibits STAT3 DNA-binding activity. Target: Others. Smiles: N(S(=O)(=O)C1=C(F)C(F)=C(F)C(F)=C1F)C=2C3=C(C(O)=C(SC4=CC=CC=C4)C2)C=CC=C3
| Anwendung: | STAT3 inhibitor |
| CAS | 1809581-87-0 |
| MW: | 497.46 D |
ab 208,00 €
MM-206
Artikelnummer: Cay22032-10
MM-206 is an inhibitor of STAT3 (IC50 = 1.16 µM in an SPR-based competitive assay). It inhibits STAT3 phosphorylation induced by granulocyte colony-stimulating factor (G-CSF) in HL-60, Kasumi-1, and MOLM-13 acute myeloid leukemia (AML) cells (IC50s = 0.8, 1.9, and 1.1 µM, respectively). MM-206 induces apoptosis more...
| Schlagworte: | 2,3,4,5,6-pentafluoro-N-[4-hydroxy-3-(phenylthio)-1-naphthalenyl]-benzenesulfonamide |
| Anwendung: | STAT3 inhibitor |
| CAS | 1809581-87-0 |
| MW: | 497.5 D |
ab 114,00 €
