Zu "1803193-57-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Pimozide-d4
Artikelnummer: TGM-T12476-10mg
Description: Pimozide D4 is a deuterium labeled Pimozide. Smiles: O=C1N(C=2C(N1)=CC=CC2)C3CCN(CCCC(C4=C(C(=C(F)C(=C4[2H])[2H])[2H])[2H])C5=CC=C(F)C=C5)CC3. References: Ybema CE, et al. Adrenoceptors and dopamine receptors are not involved in the discriminative stimulus effect of the 5-HT1A receptor agonist...
| Schlagworte: | R6238 D4, Pimozide D4 |
| Anwendung: | GC-MS, LC-MS, internal standard, quantification, dopamine D2/D3-receptor antagonist |
| CAS | 1803193-57-8 |
| MW: | 465.57 D |
ab 909,00 €
Pimozide-d4
Artikelnummer: Cay28617-1
Pimozide-d4 is an internal standard for the quantification of pimozide (Cay-16222) by GC- or LC-MS. Pimozide is a dopamine receptor antagonist (Kis = 2.4, 0.3, and 1.8 nM for D2, D3, and D4 receptors, respectively). It also binds to eight additional receptors (Kds = 25-3,100 nM for the human receptors) and inhibits...
| Schlagworte: | 1-[1-[4-(4-fluorophenyl)-4-(4-fluorophenyl-2,3,5,6-d4)butyl]-4-piperidinyl]-1,3-dihydro-2H-benzimidazol-2-one |
| Anwendung: | GC-MS, LC-MS, Internal standard, Quantification, Dopamine D2/D3-receptor antagonist |
| CAS | 1803193-57-8 |
| MW: | 465.6 D |
649,00 €
