Zu "1802326-66-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
JNJ-63533054
Artikelnummer: TGM-T3119-100mg
Description: JNJ-63533054 is a potent and selective agonist of hGPR139 with an EC50 = 16 nM. Target: GPR. Smiles: C[C@H](NC(=O)CNC(=O)c1cccc(Cl)c1)c1ccccc1. References: Dvorak CA, et al. ACS Med Chem Lett. 2015 Jul 20,6(9):1015-8.
| Schlagworte: | JNJ 63533054 |
| Anwendung: | GPR139 agonist |
| CAS | 1802326-66-4 |
| MW: | 316.78 D |
ab 31,00 €
JNJ-63533054
Artikelnummer: Cay23450-1
JNJ-63533054 is a potent agonist of the orphan G protein-coupled receptor GPR139 (EC50 = 16 nM in HEK293 cells expressing human GPR139). It is selective for GPR139 over 50 known G protein-coupled receptors, ion channels, and transporters as determined by an external selectivity panel. Tritium-labeled JNJ-63533054...
| Schlagworte: | 3-chloro-N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]-benzamide |
| Anwendung: | GPR139 agonist |
| CAS | 1802326-66-4 |
| MW: | 316.8 D |
ab 44,00 €
