Zu "1794789-93-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Vilazodone-d8
Artikelnummer: TGM-T13300-1mg
Description: Vilazodone D8 is a deuterium-labeled vilazodone. Vilazodone is a combined inhibitor of serotonin specific reuptake (SSRI) and agonist of 5-HT1A receptor partial. Smiles: [2H]C1([2H])N(CCCCc2c[nH]c3ccc(cc23)C#N)C([2H])([2H])C([2H])([2H])N(c2ccc3oc(cc3c2)C(N)=O)C1([2H])[2H]
| Anwendung: | Serotonin antagonist and reuptake inhibitor (SARI), GC-MS, LC-MS, internal standard |
| CAS | 1794789-93-7 |
| MW: | 449.57 D |
ab 351,00 €
Vilazodone-d8
Artikelnummer: Cay25712-1
Vilazodone-d8 is intended for use as an internal standard for the quantification of vilazodone (Cay-21547) by GC- or LC-MS. Vilazodone is a selective serotonin reuptake inhibitor (SSRI) and a partial agonist of the serotonin (5-HT) receptor subtype 5-HT1A (IC50s = 0.2 and 0.5 nM, respectively). It increases...
| Schlagworte: | 5-(4-(4-(5-cyano-1H-indol-3-yl)butyl)piperazin-1-yl-2,2,3,3,5,5,6,6-d8)benzofuran-2-carboxamide |
| Anwendung: | Serotonin antagonist and reuptake inhibitor (SARI), GC-MS, LC-MS, internal standard |
| CAS | 1794789-93-7 |
| MW: | 449.6 D |
556,00 €
