Zu "176957-55-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CCT007093
Artikelnummer: TGM-T1927-100mg
Description: CCT007093 is an effective PPM1D (WIP1) inhibitor (IC50: 8.4 µM). Target: Apoptosis, Phosphatase, Autophagy. Smiles: O=C1\C(CC\C1=C/c1cccs1)=C\c1cccs1. References: Rayter S, et al. Oncogene. 2008, 27(8), 1036-1044.
| Anwendung: | PPM1D inhibitor |
| CAS | 176957-55-4 |
| MW: | 272.39 D |
ab 40,00 €
CCT007093
Artikelnummer: Cay19992-1
CCT007093 is an inhibitor of protein phosphatase 1D (PPM1D, also known as PP2Cdelta and WIP1, IC50 = 8.4 µM), which is encoded by a putative oncogene that is amplified in multiple cancer types. It does not inhibit PPM1A. CCT007093 selectively inhibits the growth of cancer cells that overexpress PPM1D, including...
| Schlagworte: | 2E,5E-bis(2-thienylmethylene)-cyclopentanone |
| Anwendung: | PPM1D inhibitor |
| CAS | 176957-55-4 |
| MW: | 272.4 D |
ab 44,00 €
