Zu "17364-16-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
1-Palmitoyl-sn-glycero-3-phosphocholine
Artikelnummer: TGM-T8712-100mg
Description: 1-Palmitoyl-sn-glycero-3-phosphocholine (1-Hexadecanoyl-sn-glycero-3-phosphocholine) is a phosphocholine utilized in the design of fluorescent probes. Target: Others. Smiles: CCCCCCCCCC CCCCCC(=O)OC[C@@H](O)COP([O-])(=O)OCC[N+](C)(C)C. References: D.B.J. Herrmann, E Ferber, P G Munder. Ether...
| Schlagworte: | 1-Hexadecanoyl-sn-glycero-3-phosphocholine |
| Anwendung: | Quantitative analytical standard, MaxSpec |
| CAS | 17364-16-8 |
| MW: | 495.63 D |
ab 40,00 €
Lipid-based Drug Delivery-Tools
1-Palmitoyl-2-hydroxy-sn-glycero-3-PC
Artikelnummer: Cay10172-25
1-Palmitoyl-2-hydroxy-sn-glycero-3-PC is the ubiquitous lipid species generated following phospholipase A2 (PLA2) hydrolysis of phosphatidylcholine. It increases the production of reactive oxygen species (ROS) and decreases superoxide dismutase (SOD) and endothelial nitric oxide synthase (eNOS) protein levels and...
| Schlagworte: | 16:0/0:0-PC, 1-Hexadecanoyl-sn-glycero-3-Phosphatidylcholine, 1-Hexadecanoyl-sn-glycero-3-Phosphocholine,... |
| Anwendung: | Bioactive lipid assays |
| CAS | 17364-16-8 |
| MW: | 495.6 D |
ab 62,00 €
