Zu "172922-91-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
FICZ
Artikelnummer: TGM-TQ0257-1mg
Description: FICZ (6-Formylindolo[3,2-b]carbazole) is a potent aryl agonist for the hydrocarbon receptor (AhR, Kd: 70 pM). Target: Aryl Hydrocarbon Receptor. Smiles: O=Cc1c2[nH]c3ccccc3c2cc2[nH]c3ccccc3c12. References: Mohammadi-Bardbori A, et al. The highly bioactive molecule and signal substance...
| Schlagworte: | 6-Formylindolo[3,2-b]carbazole |
| Anwendung: | AhR agonist |
| CAS | 172922-91-7 |
| MW: | 284.31 D |
ab 47,00 €
![6-Formylindolo[3,2-b]carbazole](https://www.biomol.com/media/image/67/54/71/Cay19529-1_200x200.png "6-Formylindolo[3,2-b]carbazole")
6-Formylindolo[3,2-b]carbazole
Artikelnummer: Cay19529-1
6-Formylindolo[3,2-b]carbazole (FICZ) is a degradation product of tryptophan upon exposure to visible light that activates the aryl hydrocarbon receptor (AhR, Kd = 70 pM). This endogenous AhR ligand is also a good substrate for cytochromes P450 (CYP) 1A1, 1A2, and 1B1 (Kis = 15.4, 3.9, and 13.3 µM, respectively)....
| Schlagworte: | FICZ, 5,11-dihydro-indolo[3,2-b]carbazole-6-carboxaldehyde |
| Anwendung: | AhR agonist |
| CAS | 172922-91-7 |
| MW: | 284.3 D |
ab 84,00 €
