Zu "172889-26-8" wurden 5 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
PP1
Artikelnummer: TGM-T6196-100mg
Description: PP1 (AGL 1872), a specific and effective Src inhibitor, is with IC50 for Lck/Fyn is 5 nM/ 6 nM, respectively. Target: Src, EGFR, Bcr-Abl, Apoptosis, c-Kit. Smiles: NC1=C2C(=NN(C(C)(C)C)C2=NC=N1)C3=CC=C(C)C=C3. References: Hanke JH, et al. J Biol Chem, 1996, 271(2), 695-701.
| Schlagworte: | AGL 1872, EI 275 |
| Anwendung: | Tyrosine kinase inhibitor |
| CAS | 172889-26-8 |
| MW: | 281.36 D |
ab 34,00 €
PP1 (Src Inhibitor)
Artikelnummer: Cay14244-1
PP1 is a potent, reversible, ATP-competitive, and selective inhibitor of the Src family of protein tyrosine kinases. It inhibits p56lck (IC50 = 5 nM), p59fynT (IC50 = 6 nM), Hck (IC50 = 20 nM), and Src (IC50 = 170 nM) without significantly affecting the activity of EGFR kinase (IC50 = 250 nM), JAK2 (IC50 = 50 µM),...
| Schlagworte: | AGL 1872, EI 275, 1-(1,1-dimethylethyl)-3-(4-methylphenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| Anwendung: | Tyrosine kinase inhibitor |
| CAS | 172889-26-8 |
| MW: | 281.4 D |
ab 66,00 €
PP1
Artikelnummer: AG-CR1-3562-M005
Highly potent and selective Scr family tyrosine kinase inhibitor. Shows anti-Ras cancer potential by blocking Ras-induced activation of PAK1. Antitumor compound. RIP2 inhibitor. Blocks TGF-beta-mediated cellular responses.
| Schlagworte: | 4-Amino-5-(methylphenyl)-7-(tert.butyl)pyrazolo-(3,4-d)pyrimidine |
| Anwendung: | Tyrosine kinase inhibitor |
| CAS | 172889-26-8 |
| MW: | 281,4 D |
ab 44,00 €
![4-Amino-1-tert-butyl-3-(4-methylphenyl)pyrazolo[3,4-d]pyrimidine](https://www.biomol.com/media/image/07/20/13/N0032-30-10_200x200.jpg "4-Amino-1-tert-butyl-3-(4-methylphenyl)pyrazolo[3,4-d]pyrimidine")
4-Amino-1-tert-butyl-3-(4-methylphenyl)pyrazolo[3,4-d]pyr...
Artikelnummer: N0032-30.10
A highly potent and uniquely specific tyrosine kinase inhibitor of a rationally engineered v-Src tyrosine kinase. Melting Point: 190-192°C, Solubility: Chloroform, Ethyl Acetate, Method for Determining Identity: Proton NMR (CDCl3) Spectroscopic and Mass Spectrometric Analysis, TLC Conditions: SiO2:...
| CAS | 172889-26-8 |
| MW: | 281.3 kD |
477,00 €
PP-1
Artikelnummer: LKT-P6232.25
Src inhibitor.
| Schlagworte: | 4-Amino-1-tert-butyl-3-(4-methylphenyl)pyrazolo[3,4-d]pyrimidine |
| Anwendung: | Inhibitor of Src family tyrosine kinases |
| CAS | 172889-26-8 |
| MW: | 281,36 D |
ab 198,00 €
