Zu "171235-71-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
(S,S)-TAPI-1
Artikelnummer: TGM-T63390-1mg
Description: (S,S)-TAPI-1, an isomer of TAPI-1, is a metalloproteinase (MMP) inhibitor and a TACE (ADAM17) inhibitor known for its potent inhibition of various cell surface protein shedding. Target: Others. Smiles: CC(C)CC(CC(=O)NO)C(=O)NC(Cc1ccc2ccccc2c1)C(=O)NC(C)C(=O)NCCN
| Anwendung: | ADAM17 inhibitor |
| CAS | 171235-71-5 |
| MW: | 499.6 D |
ab 371,00 €
TAPI-1
Artikelnummer: Cay18505-500
TNF-alpha converting enzyme (TACE, also known as ADAM17) is a zinc metalloprotease that cleaves the membrane-bound precursor of TNF-alpha to give the mature soluble form of TNF-alpha. It also mediates the proteolytic release of several other cell-surface proteins, including TNF-alpha receptors (TNFRs). TAPI-1, known...
| Schlagworte: | TAPI, N-[2-[2-(hydroxyamino)-2-oxoethyl]-4-methyl-1-oxopentyl]-3-(2-naphthalenyl)-L-alanyl-N-(2-aminoethyl)-... |
| Anwendung: | ADAM17 inhibitor |
| CAS | 171235-71-5 |
| MW: | 499.6 D |
ab 204,00 €
