Zu "170713-71-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Aureusimine B
Artikelnummer: TGM-T37753-100mg
Description: Aureusimine B, a Calpain inhibitor, is produced by Staphylococcus aureus biofilms and could be a potential biomarker for S. aureus biofilm-based infections. Target: Antibacterial, Cysteine Protease. Smiles: CC(C)c1ncc(Cc2ccccc2)[nH]c1=O. References: Secor PR, Jennings LK, James GA, Kirker KR, Pulcini...
| Anwendung: | Natural pyrazinon, calpain inhibitor |
| CAS | 170713-71-0 |
| MW: | 228.29 D |
ab 148,00 €
Aureusimine B
Artikelnummer: Cay18752-1
Aureusimine B, also known as phevalin, is a natural pyrazinone produced by certain fungi and by Staphylococcus spp., including S. aureus. Its synthesis appears to be initiated by a conserved nonribosomal peptide synthetase that creates a dipeptide (phenylalanine-valine) aldehyde, which then undergoes cyclization and...
| Schlagworte: | Phevalin, 3-(1-methylethyl)-6-(phenylmethyl)-2(1H)-pyrazinone |
| Anwendung: | Natural pyrazinon, Calpain inhibitor |
| CAS | 170713-71-0 |
| MW: | 228.3 D |
ab 293,00 €
