Zu "170571-01-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Celecoxib Carboxylic Acid
Artikelnummer: TGM-T36187-10mg
Description: Celecoxib carboxylic acid is an inactive metabolite of the COX-2 inhibitor celecoxib .1,2It is formed from celecoxib primarily by the cytochrome P450 (CYP) isoform CYP2C9. Target: Others. Smiles: NS(=O)(=O)c1ccc(cc1)-n1nc(cc1-c1ccc(cc1)C(O)=O)C(F)(F)F. References: Liu, H., Huang, X., Shen, J., et...
| Anwendung: | Inactive celecoxib metabolite |
| CAS | 170571-01-4 |
| MW: | 411.36 D |
ab 264,00 €
Celecoxib Carboxylic Acid
Artikelnummer: Cay34062-10
Celecoxib carboxylic acid is an inactive metabolite of the COX-2 inhibitor celecoxib (Cay-10008672). It is formed from celecoxib primarily by the cytochrome P450 (CYP) isoform CYP2C9.Formal Name: 4-[1-[4-(aminosulfonyl)phenyl]-3-(trifluoromethyl)-1H-pyrazol-5-yl]-benzoic acid. CAS Number: 170571-01-4. Molecular...
| Schlagworte: | 4-[1-[4-(aminosulfonyl)phenyl]-3-(trifluoromethyl)-1H-pyrazol-5-yl]-benzoic acid |
| Anwendung: | Inactive celecoxib metabolite |
| CAS | 170571-01-4 |
| MW: | 411.4 D |
ab 145,00 €
