Zu "168682-53-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ezatiostat
Artikelnummer: TGM-T5097-100mg
Description: Ezatiostat (TER199(free base)) is a tripeptide analog of glutathione that can selectively inhibit GSTP1-1 catalytic activity. Target: GST, Apoptosis, Glutathione Peroxidase. Smiles: CCOC(=O)[C@@H](N)CCC(=O)N[C@@H](CSCc1ccccc1)C(=O)N[C@@H](C(=O)OCC)c1ccccc1. References: Raza A, et al. Phase 1...
| Schlagworte: | TLK199, TER199(free base) |
| Anwendung: | GSTP1-1 inhibitor |
| CAS | 168682-53-9 |
| MW: | 529.65 D |
ab 32,00 €
Ezatiostat
Artikelnummer: Cay16248-10
Ezatiostat is an inhibitor of glutathione S-transferase pi 1-1 (GSTP1-1, Ki = 0.4 µM). It is selective for GSTP1-1 over GSTalpha and GSTµ family GSTs (Kis = 20-75 µM). Ezatiostat also inhibits the protein-protein interaction between GSTP1-1 and JNK1. In vivo, ezatiostat (75 mg/kg) increases the number of circulating...
| Schlagworte: | Terrapin 199, TLK199, (2R)-L-gamma-glutamyl-S-(phenylmethyl)-L-cysteinyl-2-phenyl-glycine-1,3-diethyl ester |
| Anwendung: | GSTP1-1 inhibitor |
| CAS | 168682-53-9 |
| MW: | 529.7 D |
ab 43,00 €
