Zu "165538-40-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Terutroban
Artikelnummer: TGM-T5505-10mg
Description: Terutroban, a thromboxane prostaglandin receptor antagonist, affects the progression of atherosclerosis. Target: Prostaglandin Receptor. Smiles: Cc1ccc2C[C@@H](CCc2c1CCC(O)=O)NS(=O)(=O)c1ccc(Cl)cc1. References: Bots ML, et al. Thromboxane prostaglandin receptor antagonist and carotid atherosclerosis...
| Anwendung: | TXA2 receptor antagonist |
| CAS | 165538-40-9 |
| MW: | 407.91 D |
ab 46,00 €
S18886
Artikelnummer: Cay14059-5
The lipid mediator thromboxane A2 (TXA2) plays a key role in platelet aggregation and vascular and bronchial smooth muscle constriction. The actions of TXA2 are mediated by its specific G protein coupled-receptor, referred to as the TXA2 receptor or TP. S18886 is an orally active, long-acting antagonist of the TP...
| Schlagworte: | Terutroban, Triplion, (6R)-6-[[(4-chlorophenyl)sulfonyl]amino]-5,6,7,8-tetrahydro-2-methyl-1-naphthalenepropanoic |
| Anwendung: | TXA2 receptor antagonist |
| CAS | 165538-40-9 |
| MW: | 407.9 D |
ab 100,00 €
