Zu "1643368-58-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
BMS-986142
Artikelnummer: TGM-T5138-100mg
Description: BMS-986142 is a potent and highly selective reversible BTK inhibitor (IC50: 0.5 nM). Target: BTK. Smiles: Cc1c(cccc1-n1c(=O)n(C)c2c(F)cccc2c1=O)-c1c(F)cc(C(N)=O)c2[nH]c3C[C@H](CCc3c12)C(C)(C)O. References: Watterson SH, et al. Discovery of...
| Anwendung: | BTK inhibitor |
| CAS | 1643368-58-4 |
| MW: | 572.6 D |
ab 142,00 €
BMS 986142
Artikelnummer: Cay30927-5
BMS 986142 is a Bruton's tyrosine kinase (BTK) inhibitor (IC50 = 0.5 nM). It is greater than 20-fold selective for BTK over a panel of 384 kinases. BMS 986142 inhibits calcium flux in Ramos B cells induced by B cell receptor (BCR) stimulation (IC50 = 9 nM), as well as BCR stimulation-induced proliferation of, and...
| Schlagworte: | (2S,5R)-6-fluoro-5-[(3S)-3-(8-fluoro-1,4-dihydro-1-methyl-2,4-dioxo-3(2H)-quinazolinyl)-2-methylphenyl]-2,3,4,9-tetrahydro... |
| Anwendung: | BTK inhibitor |
| CAS | 1643368-58-4 |
| MW: | 572.6 D |
ab 111,00 €
