Zu "1642857-69-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
TLR7 agonist 2
Artikelnummer: TGM-T4258-100mg
Description: TLR7 agonist 2 (TLR7-IN-1) is a specific and effective Toll-like Receptor 7 (TLR7) agonist (LEC=0.4 µM). Target: TLR. Smiles: Cc1cc(COc2nc(N)nc3ccn(Cc4ccccn4)c23)no1. References: McGowan DC, et al. Identification and Optimization of Pyrrolo[3,2-d]pyrimidine Toll-like Receptor 7 (TLR7) Selective Agonists...
| Schlagworte: | TLR7-agonist-1, TLR7-IN-1 |
| Anwendung: | Toll-like receptor 7 agonist |
| CAS | 1642857-69-9 |
| MW: | 336.35 D |
ab 155,00 €
TLR7 Agonist 2
Artikelnummer: Cay28450-1
TLR agonist 2 is a toll-like receptor 7 (TLR7) agonist with a lowest effective concentration (LEC) value of 0.4 µM in a cell-based reporter assay. It is selective for TLR7 over TLR8 (LEC = >100 µM). TLR7 agonist 2 (0.3-10 mg/kg) increases IFN-alpha levels and the IFN-stimulated gene (ISG) response, increasing the...
| Schlagworte: | 4-[(5-methyl-3-isoxazolyl)methoxy]-5-(2-pyridinylmethyl)-5H-pyrrolo[3,2-d]pyrimidin-2-amine |
| Anwendung: | Toll-like receptor 7 agonist |
| CAS | 1642857-69-9 |
| MW: | 336.4 D |
ab 163,00 €
