Zu "1640226-17-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
YIL781 hydrochloride
Artikelnummer: TGM-T29174-2mg
Description: YIL781 is a ghrelin receptor antagonist (GHS-R1a) (Ki = 17 nM) with no significant affinity for the motilin receptor (Ki = 6 µM). Target: Others. Smiles: Cl.CC(C)N1CCC[C@H](Cn2c(C)nc3ccc(Oc4ccc(F)cc4)cc3c2=O)C1. References: Moran and Dailey (2009) Gut peptides: targets for antiobesity drug development?...
| Schlagworte: | YIL-781, YIL 781, YIL781, YIL781 HCl |
| Anwendung: | GHS-R1a antagonist |
| CAS | 1640226-17-0 |
| MW: | 445.96 D |
77,00 €
YIL 781 (hydrochloride)
Artikelnummer: Cay29217-1
YIL 781 is an antagonist of the growth hormone secretagogue receptor 1a (GHS-R1a, Ki = 0.017 µM). It is selective for GHS-R1a over the motilin receptor (Ki = 6 µM) and a panel of 30 receptors and enzymes (Kis = >10 µM). YIL 781 (1 µM) prevents ghrelin-induced decreases in insulin secretion in glucose-stimulated...
| Schlagworte: | 6-(4-fluorophenoxy)-2-methyl-3-[[(3S)-1-(1-methylethyl)-3-piperidinyl]methyl]-4(3H)-quinazolinone, monohydrochloride |
| Anwendung: | GHS-R1a antagonist |
| CAS | 1640226-17-0 |
| MW: | 446 D |
ab 55,00 €
