Zu "1632118-69-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
BAR501
Artikelnummer: TGM-T4083-100mg
Description: BAR501 is an effective and specific GPBAR1 agonist (EC50: 1 µM). Target: GPCR19. Smiles: CC[C@@H]1[C@H](O)[C@H]2[C@@H]3CC[C@H]([C@H](C)CCCO)[C@@]3(C)CC[C@@H]2[C@@]2(C)CC[C@@H](O)C[C@@H]12. References: Renga B, et al. Reversal of Endothelial Dysfunction by GPBAR1 Agonism in Portal Hypertension Involves a...
| Schlagworte: | BAR 501 |
| Anwendung: | Selective GPBAR1 agonist |
| CAS | 1632118-69-4 |
| MW: | 406.64 D |
ab 56,00 €
BAR501
Artikelnummer: Cay22460-1
BAR501 is a selective agonist of the G protein-coupled bile acid-activated receptor (GP-BAR1, EC50 = 1 µM) that lacks activity at the farnesoid X receptor (FXR). In vivo, BAR501 reduces hepatic perfusion pressure and counteracts norepinephrine-induced vasoconstriction in naïve rats. It protects against development...
| Schlagworte: | (3alpha,5beta,6beta,7beta)-6-ethyl-cholane-3,7,24-triol |
| Anwendung: | Selective GPBAR1 agonist |
| CAS | 1632118-69-4 |
| MW: | 406.6 D |
ab 50,00 €
