Zu "1632006-28-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Esaxerenone
Artikelnummer: Cay41082-10
Esaxerenone is a non-steroidal mineralocorticoid receptor antagonist (IC50 = 9.4 nM). It is selective for mineralocorticoid receptors over glucocorticoid, androgen, and progesterone receptors (IC50s = >10,000 nM for all). Esaxerenone (0.3, 1, or 3 mg/kg) increases the urinary ratio of sodium to potassium in...
| Schlagworte: | CS-3150, 1-(2-hydroxyethyl)-4-methyl-N-[4-(methylsulfonyl)phenyl]-5S-[2-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide |
| Anwendung: | Non-steroidal mineralocorticoid receptor antagonist |
| CAS | 1632006-28-0 |
| MW: | 466.5 D |
ab 181,00 €
Esaxerenone
Artikelnummer: TGM-T15246-100mg
Description: Esaxerenone (XL-550) is a highly potent and selective non-steroidal antagonist of the mineralocorticoid receptor. Target: Glucocorticoid Receptor. Smiles: Cc1c(cn(CCO)c1-c1ccccc1C(F)(F)F)C(=O)Nc1ccc(cc1)S(C)(=O)=O. References: Yamada M, et al. Pharmacokinetics, distribution, and disposition of...
| Schlagworte: | CS-3150, XL-550 |
| Anwendung: | Targets mineralocorticoid receptor (NR3C2, MR) |
| CAS | 1632006-28-0 |
| MW: | 466.47 D |
ab 63,00 €
