Zu "1628208-23-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CPI-455
Artikelnummer: TGM-T3552-100mg
Description: CPI-455 is a specific KDM5 inhibitor. Target: Histone Demethylase. Smiles: CC(C)c1c([nH]c2c(cnn2c1=O)C#N)-c1ccccc1. References: Vinogradova M, et al. Nat Chem Biol. 2016, 12(7):531-8.
| Schlagworte: | CPI-455 HCl |
| Anwendung: | KDM5A/B/C histone demethylase inhibitor |
| CAS | 1628208-23-0 |
| MW: | 278.31 D |
ab 37,00 €
CPI-455
Artikelnummer: Cay22127-1
CPI-455 is an inhibitor of the lysine demethylase 5 family (KDM5A-D). CPI-455 binds to the demethylase active site and selectively inhibits KDM5A-D (IC50s = 2-10 nM) over KDM2-4, 6, and 7 family members (IC50s = 1 to >25 µM). It increases histone H3K4me2/3 methylation in vitro and decreases the number of...
| Schlagworte: | 4,7-dihydro-6-(1-methylethyl)-7-oxo-5-phenyl-pyrazolo[1,5-a]pyrimidine-3-carbonitrile |
| Anwendung: | KDM5A/B/C histone demethylase inhibitor |
| CAS | 1628208-23-0 |
| MW: | 278.3 D |
ab 35,00 €
