Zu "162359-55-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Fingolimod
Artikelnummer: TGM-T7939-100mg
Description: Fingolimod (FTY-720A) is an antagonist of sphingosine 1-phosphate (S1P) (IC50 of 0.033 nM in K562 and NK cells). Target: PAK, S1P Receptor, LPL Receptor. Smiles: CCCCCCCCc1ccc(CCC(N)(CO)CO)cc1. References: Szepanowski, Fabian, Derksen, Angelika, Steiner, Irina,et al. Fingolimod promotes peripheral...
| Schlagworte: | FTY-720A, FTY-720 |
| Anwendung: | Targets sphingosine 1-phosphate receptor 1 (S1PR1, EDG1, CD363) |
| CAS | 162359-55-9 |
| MW: | 307.47 D |
ab 49,00 €
Fingolimod
Artikelnummer: Cay11975-5
Fingolimod is an immune modulator, a prodrug form of the sphingosine-1-phosphate (S1P) receptor agonist FTY720 phosphate (Cay-10008639), and a derivative of myriocin (Cay-63150). It selectively inhibits calcium-dependent cytosolic phospholipase A2 (cPLA2) over calcium-independent PLA2 (iPLA2) and secretory PLA2...
| Schlagworte: | 2-amino-2-[2-(4-octylphenyl)ethyl]-1,3-propanediol |
| Anwendung: | S1P receptor agonist |
| CAS | 162359-55-9 |
| MW: | 307.5 D |
ab 77,00 €
