Zu "1619994-69-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Bromosporine
Artikelnummer: TGM-T6255-100mg
Description: Bromosporine is a broad spectrum inhibitor for bromodomains for BRD2/4/9 and CECR2 (IC50: 0.41/0.29/0.122/0.017 µM), respectively. Target: CDK, Epigenetic Reader Domain. Smiles: CCOC(=O)Nc1cc(nn2c(C)nnc12)-c1ccc(C)c(NS(C)(=O)=O)c1. References: 15th HELLENIC SYMPOSIUM OF MEDICINAL CHEMISTRY.
| Anwendung: | Non-selective bromodomain inhibitor |
| CAS | 1619994-69-2 |
| MW: | 404.44 D |
ab 45,00 €
Bromosporine
Artikelnummer: Cay14119-1
Bromodomains play a key role in many cellular processes, including inflammatory gene expression, mitosis, and viral/host interaction, by controlling the assembly of histone acetylation-dependent chromatin complexes. They serve as "readers" of histone acetylation marks, regulating the transcription of target...
| Schlagworte: | ethyl (3-methyl-6-(4-methyl-3-(methylsulfonamido)phenyl)-[1,2,4]triazolo[4,3-b]pyridazin-8-yl)carbamate |
| Anwendung: | Non-selective bromodomain inhibitor |
| CAS | 1619994-69-2 |
| MW: | 404.4 D |
ab 52,00 €
