Zu "1609564-75-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
DY268
Artikelnummer: TGM-T31587-100mg
Description: DY268 is a compound based on trisubstituted pyrazolamide without any FXR agonist activity and cytotoxicity and can be used as an effective FXR antagonist (IC50 = 7.5 nM). Target: FXR. Smiles: C(NC1=CC(S(=O)(=O)N2CCOCC2)=C(C)C=C1)(=O)C=3C(=NN(CC4=CC(OC)=CC=C4)C3)C5=CC=C(C)C=C5. References: Roman-Lopez J,...
| Schlagworte: | DY-268, DY 268 |
| Anwendung: | Farnesoid X receptor (FXR) antagonist |
| CAS | 1609564-75-1 |
| MW: | 560.66 D |
ab 34,00 €
DY 268
Artikelnummer: Cay29475-1
DY 268 is a farnesoid X receptor (FXR) antagonist (IC50 = 7.5 nM in a time-resolved FRET assay). It inhibits FXR transactivation in a cell-based assay with an IC50 value of 468 nM.Formal Name: 1-[(3-methoxyphenyl)methyl]-N-[4-methyl-3-(4-morpholinylsulfonyl)phenyl]-3-(4-methylphenyl)-1H-pyrazole-4-carboxamide. CAS...
| Schlagworte: | 1-[(3-methoxyphenyl)methyl]-N-[4-methyl-3-(4-morpholinylsulfonyl)phenyl]-3-(4-methylphenyl)-1H-pyrazole-4-carboxamide |
| Anwendung: | Farnesoid X receptor (FXR) antagonist |
| CAS | 1609564-75-1 |
| MW: | 560.7 D |
ab 43,00 €
