Zu "153559-76-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
LG100268
Artikelnummer: TGM-T19703-2mg
Description: LG100268 is an effective and selective rexinoid and retinoid-X receptor agonist. LG100268 binds to the alpha, beta, and gamma RXR receptors (IC50 = 3-4 nM). Target: Others. Smiles: CC1=C(C2(CC2)C3=CC=C(C(O)=O)C=N3)C=C4C(=C1)C(C)(C)CCC4(C)C. References: Cao M, Royce DB, Risingsong R, Williams CR, Sporn...
| Schlagworte: | LG 100268, LG-100268 |
| Anwendung: | RXR agonist |
| CAS | 153559-76-3 |
| MW: | 363.49 D |
59,00 €
LG 100268
Artikelnummer: Cay21606-1
LG 100268 is an agonist of retinoid X receptors (RXRs, Kd = 3 nM). It is selective for RXRs over retinoic acid receptors (RARs, Kd = >10,000 nM). In vitro, LG 100268 (1 µM) induces apoptosis in HL-60 human leukemia cells when used in combination with TTNPB (Cay-16144). LG 100268 (100, 300, and 1,000 nM)...
| Schlagworte: | AGN 192620, CD3127, 6-[1-(5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenyl)cyclopropyl]-3-pyridinecarboxylic acid |
| Anwendung: | RXR agonist |
| CAS | 153559-76-3 |
| MW: | 363.5 D |
ab 60,00 €
