Zu "153436-53-4" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AG-1478
Artikelnummer: TGM-T2047-100mg
Description: AG-1478 (NSC-693255) (Tyrphostin AG-1478) is a selective EGFR inhibitor. Target: HER, PDGFR, EGFR, HCV Protease, Influenza Virus. Smiles: N(C=1C2=C(C=C(OC)C(OC)=C2)N=CN1)C3=CC(Cl)=CC=C3. References: Levitzki A, et al. Science, 1995, 267(5205), 1782-1788.
| Schlagworte: | Tyrphostin AG-1478, NSC 693255, AG1478 |
| Anwendung: | EGF receptor kinase inhibitor |
| CAS | 153436-53-4 |
| MW: | 315.75 D |
ab 45,00 €
AG-1478
Artikelnummer: Cay10010244-5
Protein tyrosine kinase (PTK) inhibitors are potential antiproliferative agents for diseases caused by the hyperactivity of PTK. Tyrphostins are a class of antiproliferative compounds which act as PTK blockers. PTK inhibitors which preferentially inhibit the epidermal growth factor receptor (EGFR) kinase and block...
| Schlagworte: | NSC 693255, Tyrphostin AG-1478, N-(3-chlorophenyl)-6,7-dimethoxy-4-quinazolinamine |
| Anwendung: | EGF receptor kinase inhibitor |
| CAS | 153436-53-4 |
| MW: | 315.8 D |
ab 30,00 €
AG-1478
Artikelnummer: LKT-A2500.5
EGFR inhibitor
| Schlagworte: | Tyrphostin AG1478, NSC693255 |
| Anwendung: | EGFR inhibitor |
| CAS | 153436-53-4 |
| MW: | 315.76 D |
ab 77,00 €
