Zu "1531634-31-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AF38469
Artikelnummer: TGM-TQ0086-100mg
Description: AF38469 is a new, specific and orally bioavailable Sortilin inhibitor (IC50: 330 nM). Target: Neurotensin Receptor. Smiles: Cc1cccc(NC(=O)c2ccc(cc2C(O)=O)C(F)(F)F)n1. References: Schroder TJ, et al. The identification of AF38469: an orally bioavailable inhibitor of the VPS10P family sorting receptor...
| Schlagworte: | AF-38469 |
| Anwendung: | Sortilin inhibitor |
| CAS | 1531634-31-7 |
| MW: | 324.25 D |
ab 106,00 €
AF38469
Artikelnummer: Cay35530-1
AF38469 is an inhibitor of sortilin, also known as the neurotensin-3 receptor (NTS3, IC50 = 330 nM). It is selective for sortilin over neurotensin-1 (NTS1), delta-opioid, angiotensin II type 1 (AT1), endothelin A (ETA), and ETB receptors, GPR40, PPARdelta, and matrix metalloproteinase-12 (MMP-12), and the...
| Schlagworte: | 2-[[(6-methyl-2-pyridinyl)amino]carbonyl]-5-(trifluoromethyl)-benzoic acid |
| Anwendung: | Sortilin inhibitor |
| CAS | 1531634-31-7 |
| MW: | 324.3 D |
ab 92,00 €
