Zu "15291-77-7" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ginkgolide B
Artikelnummer: TGM-T2751-1mL
Description: Ginkgolide B (BN-52021) is a PAFR antagonist(IC50=3.6 µM) isolated from Ginkgo biloba. Target: Apoptosis, Endogenous Metabolite, PAFR. Smiles: CC1C(=O)OC2C(O)C34C5CC(C(C)(C)C)C33C(O)C(=O)OC3OC4(C(=O)O5)C12O. References: Lamant V, et al. BiochemPharmacol, 1987, 36(17), 2749-2752.
| Schlagworte: | BN-52021 |
| Anwendung: | PAFr antagonist |
| CAS | 15291-77-7 |
| MW: | 424.4 D |
ab 56,00 €
Ginkgolide B
Artikelnummer: Cay14636-10
Platelet-activating factor (PAF) is an important mediator of cell proliferation, angiogenesis, inflammatory response regulation, vasodilation, superoxide formation, and platelet aggregation. These cellular effects are mediated through its specific G-protein coupled receptor, PAFR. Ginkgolide B, a terpenoid extracted...
| Schlagworte: | BN 52021, BN 52051,... |
| Anwendung: | PAFr antagonist |
| CAS | 15291-77-7 |
| MW: | 424.4 D |
ab 43,00 €
Ginkgolide B
Artikelnummer: LKT-G3355.10
One of a group of cage molecules isolated from the leaves of the Ginkgo biloba tree. A highly active platelet -activating factor (PAF) antagonist. A potential therapeutic agent in a variety of immunological and inflammatory disorders.
| Anwendung: | PAF antagonist |
| CAS | 15291-77-7 |
| MW: | 424,4 D |
ab 121,00 €
Ginkgolide B
Artikelnummer: CDX-G0218-M010
White powder. Soluble in DMSO (30mg/ml) or ethanol (10mg/ml). Chemical. CAS: 15291-77-7. Formula: C20H24O10. MW: 424.40. Ginkgolide B, a terpenoid extracted from G. biloba leaves, is a potent PAFR antagonist that inhibits platelet aggregation. Platelet-activating factor (PAF) is an important mediator of cell...
| Schlagworte: | BN-52021 |
| Wirt: | Plant |
| CAS | 15291-77-7 |
| MW: | 424,40 D |
ab 46,00 €
