Zu "150375-75-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SR 49059
Artikelnummer: Cay17972-1
SR 49059 is a selective, nonpeptide antagonist of the V1a subtype of the vasopressin receptor (Ki = 1.1-6.3 nM in human). It demonstrates >2 orders of magnitude lower affinity for V1b, V2, and oxytocin receptors and does not exhibit any intrinsic agonist activity. SR 49059 can inhibit arginine vasopressin-induced...
| Schlagworte: | Relcovaptan,... |
| Anwendung: | AVPR1A antagonist |
| CAS | 150375-75-0 |
| MW: | 620.5 D |
ab 67,00 €
SR 49059
Artikelnummer: TGM-T23393-100mg
Description: vasopressin V1A receptor antagonist. Target: Others. Smiles: [H][C@]1(N(c2ccc(Cl)cc2[C@]1(O)c1ccccc1Cl)S(=O)(=O)c1ccc(OC)c(OC)c1)C(=O)N1CCC[C@H]1C(N)=O
| CAS | 150375-75-0 |
| MW: | 620.5 D |
ab 732,00 €
