Zu "14930-96-2" wurden 4 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Cytochalasin B
Cytochalasin B

Artikelnummer: Cay11328-10

Cytochalasin B is a cell-permeable mycotoxin which binds to the barbed end of actin, reversibly inhibiting the elongation and shortening of actin filaments. By disrupting actin polymerization, cytochalasin B blocks diverse cellular functions, including cell division, migration, phagocytosis, exocytosis, chemotaxis,...
Schlagworte: NSC 107658, Phomin,...
Anwendung: Mycotoxin
CAS 14930-96-2
MW: 479.6 D
ab 61,00 €
Bewerten
Cytochalasin B
Cytochalasin B

Artikelnummer: TGM-T7097-1mg

Description: Cytochalasin B is a mycotoxin binding to the barbed end of actin filaments. It can disrupt the formation of actin polymers (Kd: 1.4-2.2 nM for F-actin). Target: Arp2/3 Complex. Smiles: [H][C@]12[C@H](Cc3ccccc3)NC(=O)C11OC(=O)\C=C\[C@H](O)CCC[C@@H](C)C\C=C\[C@@]1([H])[C@H](O)C(=C)[C@H]2C. References:...
Schlagworte: Phomin
Anwendung: Mycotoxin
CAS 14930-96-2
MW: 479.61 D
228,00 €
Bewerten
Cytochalasin B
Cytochalasin B

Artikelnummer: AG-CN2-0504-M001

White solid. Soluble in DMSO, methanol, ethanol or DMF. Cell permeable mycotoxin, Actin polymerization inhibitor. Binds to the barbed end of actin, reversibly inhibiting the elongation and shortening of actin filaments. Induces nuclear extrusion, By disrupting actin polymerization, blocks diverse cellular functions,...
Schlagworte: Phomin, NSC 107658
Anwendung: Cell permeable mycotoxin, Actin polymerization inhibitor
CAS 14930-96-2
MW: 479,6 D
ab 55,00 €
Bewerten
Cytochalasin B
Cytochalasin B

Artikelnummer: LKT-C9879.1

An actin-disrupting agent that blocks activated hKv1.5 channels and endogenous I(K,ur) in a cytoskeleton-independent manner.
Anwendung: Actin-disrupting agent
CAS 14930-96-2
MW: 479.61 D
ab 119,00 €
Bewerten