Zu "149-91-7" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Gallic acid
Artikelnummer: TGM-T0877-1mL
Description: Gallic acid (Benzoic acid) is found in almost all plants. Plants known for their high gallic acid content include gallnuts,grapes,tea,hops and oak bark. Target: Apoptosis, COX, ROS, Ferroptosis, Endogenous Metabolite, Reactive Oxygen Species. Smiles: OC(=O)C1=CC(O)=C(O)C(O)=C1. References: Zhao B,...
| Schlagworte: | Benzoic acid, 3,4,5-Trihydroxybenzoic acid, Gallate |
| CAS | 149-91-7 |
| MW: | 170.12 D |
ab 38,00 €
Gallic Acid
Artikelnummer: Cay11846-10
Gallic acid is a phenol that has been found in C. sinensis and has diverse biological activities. It scavenges DPPH (Cay-14805) and hydroxyl radicals in cell-free assays (IC50s = 9.4 and 191 µM, respectively). Gallic acid (1-100 µM) reverses abscisic acid-induced inhibition of hypocotyl growth in A. caudatus...
| Schlagworte: | 3,4,5-Trihydroxybenzoic acid, NSC 20103, NSC 674319, 3,4,5-trihydroxy-benzoic acid |
| Anwendung: | Antioxidant |
| CAS | 149-91-7 |
| MW: | 170.1 D |
ab 43,00 €
Gallic Acid
Artikelnummer: LKT-G0145.10
Phenol found in various plant sources, used to determine phenol content of analytes.
| Schlagworte: | 3,4,5-Trihydroxybenzoic acid |
| Anwendung: | COX inhibitor |
| CAS | 149-91-7 |
| MW: | 170.12 D |
ab 57,00 €
