Zu "1481677-78-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
UNC0642
Artikelnummer: TGM-T4166-100mg
Description: UNC0642 is an effective and specific G9a/GLP inhibitor (IC50< 2.5 nM). Target: Histone Methyltransferase. Smiles: COc1cc2c(NC3CCN(CC3)C(C)C)nc(nc2cc1OCCCN1CCCC1)N1CCC(F)(F)CC1. References: Liu F, et al. Discovery of an in vivo chemical probe of the lysine methyltransferases G9a and GLP. J Med Chem. 2013...
| Schlagworte: | UNC-0642, UNC 0642 |
| Anwendung: | EHMT1 / EHMT2 inhibitor |
| CAS | 1481677-78-4 |
| MW: | 546.7 D |
ab 34,00 €
UNC0642
Artikelnummer: Cay14604-1
The methylation of lysine residues on histones plays a central role in determining euchromatin structure and gene expression. The histone methyltransferases G9a and G9a-like protein (GLP) can mono- or dimethylate lysine 9 on histone 3, contributing to early embryogenesis, genomic imprinting, and lymphocyte...
| Schlagworte: | 2-(4,4-difluoropiperidin-1-yl)-N-(1-isopropylpiperidin-4-yl)-6-methoxy-7-(3-(pyrrolidin-1-yl)propoxy)quinazolin-4-amine |
| Anwendung: | EHMT1 / EHMT2 inhibitor |
| CAS | 1481677-78-4 |
| MW: | 546.7 D |
ab 85,00 €
